C16H18ClN3O4 — CID 108866651
1-(4-amino-3-chlorophenyl)-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 108866651) has the molecular formula C16H18ClN3O4 and a molecular weight of 351.79 g/mol. Its IUPAC name is 1-(4-amino-3-chlorophenyl)-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-(4-amino-3-chlorophenyl)-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 108866651 |
| Molecular Formula | C16H18ClN3O4 |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 1-(4-amino-3-chlorophenyl)-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)Nc2ccc(N)c(Cl)c2)cc(OC)c1OC |
| InChI | InChI=1S/C16H18ClN3O4/c1-22-13-7-10(8-14(23-2)15(13)24-3)20-16(21)19-9-4-5-12(18)11(17)6-9/h4-8H,18H2,1-3H3,(H2,19,20,21) |
| InChIKey | KSOGHZOOCURYQG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|