C16H16Cl2N2O5 — CID 69011342
1-(3,5-dichloro-2-hydroxyphenyl)-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 69011342) has the molecular formula C16H16Cl2N2O5 and a molecular weight of 387.22 g/mol. Its IUPAC name is 1-(3,5-dichloro-2-hydroxyphenyl)-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-(3,5-dichloro-2-hydroxyphenyl)-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 69011342 |
| Molecular Formula | C16H16Cl2N2O5 |
| Molecular Weight | 387.22 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | 1-(3,5-dichloro-2-hydroxyphenyl)-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)Nc2cc(Cl)cc(Cl)c2O)cc(OC)c1OC |
| InChI | InChI=1S/C16H16Cl2N2O5/c1-23-12-6-9(7-13(24-2)15(12)25-3)19-16(22)20-11-5-8(17)4-10(18)14(11)21/h4-7,21H,1-3H3,(H2,19,20,22) |
| InChIKey | CKXCLMSQSXUCAI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.22 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|