C15H15ClN2O5 — CID 108871952
1-(4-chloro-2-methoxy-5-methylphenyl)-3-(3,4,5-trihydroxyphenyl)urea (PubChem CID 108871952) has the molecular formula C15H15ClN2O5 and a molecular weight of 338.75 g/mol. Its IUPAC name is 1-(4-chloro-2-methoxy-5-methylphenyl)-3-(3,4,5-trihydroxyphenyl)urea.
| Compound Name | 1-(4-chloro-2-methoxy-5-methylphenyl)-3-(3,4,5-trihydroxyphenyl)urea |
|---|---|
| PubChem CID | 108871952 |
| Molecular Formula | C15H15ClN2O5 |
| Molecular Weight | 338.75 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 1-(4-chloro-2-methoxy-5-methylphenyl)-3-(3,4,5-trihydroxyphenyl)urea |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)Nc1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C15H15ClN2O5/c1-7-3-10(13(23-2)6-9(7)16)18-15(22)17-8-4-11(19)14(21)12(20)5-8/h3-6,19-21H,1-2H3,(H2,17,18,22) |
| InChIKey | SVPDLBMGIKGPCK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.75 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|