C12H14Cl2N2O3 — CID 43328804
2-chloro-N-[(4-chloro-2-methoxy-5-methylphenyl)carbamoyl]propanamide (PubChem CID 43328804) has the molecular formula C12H14Cl2N2O3 and a molecular weight of 305.16 g/mol. Its IUPAC name is 2-chloro-N-[(4-chloro-2-methoxy-5-methylphenyl)carbamoyl]propanamide.
| Compound Name | 2-chloro-N-[(4-chloro-2-methoxy-5-methylphenyl)carbamoyl]propanamide |
|---|---|
| PubChem CID | 43328804 |
| Molecular Formula | C12H14Cl2N2O3 |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 2-chloro-N-[(4-chloro-2-methoxy-5-methylphenyl)carbamoyl]propanamide |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)NC(=O)C(C)Cl |
| InChI | InChI=1S/C12H14Cl2N2O3/c1-6-4-9(10(19-3)5-8(6)14)15-12(18)16-11(17)7(2)13/h4-5,7H,1-3H3,(H2,15,16,17,18) |
| InChIKey | JJVREUCXODFDFY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|