C20H26N2O4 — CID 108866635
1-(2,6-diethylphenyl)-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 108866635) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-(2,6-diethylphenyl)-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 108866635 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 1-(2,6-diethylphenyl)-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | CCc1cccc(CC)c1NC(=O)Nc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C20H26N2O4/c1-6-13-9-8-10-14(7-2)18(13)22-20(23)21-15-11-16(24-3)19(26-5)17(12-15)25-4/h8-12H,6-7H2,1-5H3,(H2,21,22,23) |
| InChIKey | HNOBCUIZBUACCJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |