C19H24N2O4 — CID 51253107
2-(2,6-dimethylanilino)-N-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 51253107) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is 2-(2,6-dimethylanilino)-N-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | 2-(2,6-dimethylanilino)-N-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 51253107 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 2-(2,6-dimethylanilino)-N-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(NC(=O)CNc2c(C)cccc2C)cc(OC)c1OC |
| InChI | InChI=1S/C19H24N2O4/c1-12-7-6-8-13(2)18(12)20-11-17(22)21-14-9-15(23-3)19(25-5)16(10-14)24-4/h6-10,20H,11H2,1-5H3,(H,21,22) |
| InChIKey | RPXLLJNBXIMEBM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |