C16H24N2O5 — CID 36673040
2,2-dimethyl-N-[2-oxo-2-(3,4,5-trimethoxyanilino)ethyl]propanamide (PubChem CID 36673040) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2-oxo-2-(3,4,5-trimethoxyanilino)ethyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[2-oxo-2-(3,4,5-trimethoxyanilino)ethyl]propanamide |
|---|---|
| PubChem CID | 36673040 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 2,2-dimethyl-N-[2-oxo-2-(3,4,5-trimethoxyanilino)ethyl]propanamide |
| SMILES | COc1cc(NC(=O)CNC(=O)C(C)(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C16H24N2O5/c1-16(2,3)15(20)17-9-13(19)18-10-7-11(21-4)14(23-6)12(8-10)22-5/h7-8H,9H2,1-6H3,(H,17,20)(H,18,19) |
| InChIKey | XWWTYCYRNMUZSQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |