C15H22N2O4 — CID 32736215
N-[2-(2,4-dimethoxyanilino)-2-oxoethyl]-2,2-dimethylpropanamide (PubChem CID 32736215) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is N-[2-(2,4-dimethoxyanilino)-2-oxoethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-(2,4-dimethoxyanilino)-2-oxoethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 32736215 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | N-[2-(2,4-dimethoxyanilino)-2-oxoethyl]-2,2-dimethylpropanamide |
| SMILES | COc1ccc(NC(=O)CNC(=O)C(C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C15H22N2O4/c1-15(2,3)14(19)16-9-13(18)17-11-7-6-10(20-4)8-12(11)21-5/h6-8H,9H2,1-5H3,(H,16,19)(H,17,18) |
| InChIKey | JGPPUVYCTDEFGW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |