C19H24N2O5 — CID 9105392
2-(4,5-dimethoxy-2-methylanilino)-N-(2,4-dimethoxyphenyl)acetamide (PubChem CID 9105392) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is 2-(4,5-dimethoxy-2-methylanilino)-N-(2,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-(4,5-dimethoxy-2-methylanilino)-N-(2,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 9105392 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 2-(4,5-dimethoxy-2-methylanilino)-N-(2,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CNc2cc(OC)c(OC)cc2C)c(OC)c1 |
| InChI | InChI=1S/C19H24N2O5/c1-12-8-17(25-4)18(26-5)10-15(12)20-11-19(22)21-14-7-6-13(23-2)9-16(14)24-3/h6-10,20H,11H2,1-5H3,(H,21,22) |
| InChIKey | DYJCJNRNDYUGNV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|