C18H21ClN2O4 — CID 9105369
N-(5-chloro-2-methoxyphenyl)-2-(4,5-dimethoxy-2-methylanilino)acetamide (PubChem CID 9105369) has the molecular formula C18H21ClN2O4 and a molecular weight of 364.83 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-2-(4,5-dimethoxy-2-methylanilino)acetamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-2-(4,5-dimethoxy-2-methylanilino)acetamide |
|---|---|
| PubChem CID | 9105369 |
| Molecular Formula | C18H21ClN2O4 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-2-(4,5-dimethoxy-2-methylanilino)acetamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CNc1cc(OC)c(OC)cc1C |
| InChI | InChI=1S/C18H21ClN2O4/c1-11-7-16(24-3)17(25-4)9-13(11)20-10-18(22)21-14-8-12(19)5-6-15(14)23-2/h5-9,20H,10H2,1-4H3,(H,21,22) |
| InChIKey | LPRRXJIZGFBRSO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|