C20H22ClN3O3 — CID 60536487
3-[[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]amino]-N-cyclopropyl-4-methylbenzamide (PubChem CID 60536487) has the molecular formula C20H22ClN3O3 and a molecular weight of 387.87 g/mol. Its IUPAC name is 3-[[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]amino]-N-cyclopropyl-4-methylbenzamide.
| Compound Name | 3-[[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]amino]-N-cyclopropyl-4-methylbenzamide |
|---|---|
| PubChem CID | 60536487 |
| Molecular Formula | C20H22ClN3O3 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 3-[[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]amino]-N-cyclopropyl-4-methylbenzamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CNc1cc(C(=O)NC2CC2)ccc1C |
| InChI | InChI=1S/C20H22ClN3O3/c1-12-3-4-13(20(26)23-15-6-7-15)9-16(12)22-11-19(25)24-17-10-14(21)5-8-18(17)27-2/h3-5,8-10,15,22H,6-7,11H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | ZLEALJPUKLHZAC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |