C12H13ClN2O3 — CID 2194402
N'-(5-chloro-2-methoxyphenyl)-N-cyclopropyloxamide (PubChem CID 2194402) has the molecular formula C12H13ClN2O3 and a molecular weight of 268.70 g/mol. Its IUPAC name is N'-(5-chloro-2-methoxyphenyl)-N-cyclopropyloxamide.
| Compound Name | N'-(5-chloro-2-methoxyphenyl)-N-cyclopropyloxamide |
|---|---|
| PubChem CID | 2194402 |
| Molecular Formula | C12H13ClN2O3 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | N'-(5-chloro-2-methoxyphenyl)-N-cyclopropyloxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)C(=O)NC1CC1 |
| InChI | InChI=1S/C12H13ClN2O3/c1-18-10-5-2-7(13)6-9(10)15-12(17)11(16)14-8-3-4-8/h2,5-6,8H,3-4H2,1H3,(H,14,16)(H,15,17) |
| InChIKey | HICLZRZXAYOHFE-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|