C15H11ClF2N2O3 — CID 108502213
N-(5-chloro-2-methoxyphenyl)-N'-(2,6-difluorophenyl)oxamide (PubChem CID 108502213) has the molecular formula C15H11ClF2N2O3 and a molecular weight of 340.71 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-N'-(2,6-difluorophenyl)oxamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-N'-(2,6-difluorophenyl)oxamide |
|---|---|
| PubChem CID | 108502213 |
| Molecular Formula | C15H11ClF2N2O3 |
| Molecular Weight | 340.71 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-N'-(2,6-difluorophenyl)oxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)C(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C15H11ClF2N2O3/c1-23-12-6-5-8(16)7-11(12)19-14(21)15(22)20-13-9(17)3-2-4-10(13)18/h2-7H,1H3,(H,19,21)(H,20,22) |
| InChIKey | FAULKYSELMQFLR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.71 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|