C21H17ClN2O4 — CID 108987184
N'-(5-chloro-2-methoxyphenyl)-N-(2-phenoxyphenyl)oxamide (PubChem CID 108987184) has the molecular formula C21H17ClN2O4 and a molecular weight of 396.83 g/mol. Its IUPAC name is N'-(5-chloro-2-methoxyphenyl)-N-(2-phenoxyphenyl)oxamide.
| Compound Name | N'-(5-chloro-2-methoxyphenyl)-N-(2-phenoxyphenyl)oxamide |
|---|---|
| PubChem CID | 108987184 |
| Molecular Formula | C21H17ClN2O4 |
| Molecular Weight | 396.83 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | N'-(5-chloro-2-methoxyphenyl)-N-(2-phenoxyphenyl)oxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)C(=O)Nc1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C21H17ClN2O4/c1-27-18-12-11-14(22)13-17(18)24-21(26)20(25)23-16-9-5-6-10-19(16)28-15-7-3-2-4-8-15/h2-13H,1H3,(H,23,25)(H,24,26) |
| InChIKey | IUXATLDLIJBHAQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.83 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|