C9H7ClNO4- — CID 2300901
2-(5-chloro-2-methoxyanilino)-2-oxoacetate (PubChem CID 2300901) has the molecular formula C9H7ClNO4- and a molecular weight of 228.61 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxyanilino)-2-oxoacetate.
| Compound Name | 2-(5-chloro-2-methoxyanilino)-2-oxoacetate |
|---|---|
| PubChem CID | 2300901 |
| Molecular Formula | C9H7ClNO4- |
| Molecular Weight | 228.61 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | 2-(5-chloro-2-methoxyanilino)-2-oxoacetate |
| SMILES | COc1ccc(Cl)cc1NC(=O)C(=O)[O-] |
| InChI | InChI=1S/C9H8ClNO4/c1-15-7-3-2-5(10)4-6(7)11-8(12)9(13)14/h2-4H,1H3,(H,11,12)(H,13,14)/p-1 |
| InChIKey | QMLKYGBXGRAIKU-UHFFFAOYSA-M |
| XLogP | 0.04 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.61 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|