C10H10ClN3O2 — CID 108864649
1-(5-chloro-2-methoxyphenyl)-3-(cyanomethyl)urea (PubChem CID 108864649) has the molecular formula C10H10ClN3O2 and a molecular weight of 239.66 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-(cyanomethyl)urea.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-(cyanomethyl)urea |
|---|---|
| PubChem CID | 108864649 |
| Molecular Formula | C10H10ClN3O2 |
| Molecular Weight | 239.66 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-(cyanomethyl)urea |
| SMILES | COc1ccc(Cl)cc1NC(=O)NCC#N |
| InChI | InChI=1S/C10H10ClN3O2/c1-16-9-3-2-7(11)6-8(9)14-10(15)13-5-4-12/h2-3,6H,5H2,1H3,(H2,13,14,15) |
| InChIKey | QOMOIIKAOWQQQW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.66 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|