C11H11ClN4O2S — CID 146579436
1-(5-chloro-2-methoxyphenyl)-3-[(2-cyanoacetyl)amino]thiourea (PubChem CID 146579436) has the molecular formula C11H11ClN4O2S and a molecular weight of 298.76 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-[(2-cyanoacetyl)amino]thiourea.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-[(2-cyanoacetyl)amino]thiourea |
|---|---|
| PubChem CID | 146579436 |
| Molecular Formula | C11H11ClN4O2S |
| Molecular Weight | 298.76 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-[(2-cyanoacetyl)amino]thiourea |
| SMILES | COc1ccc(Cl)cc1NC(=S)NNC(=O)CC#N |
| InChI | InChI=1S/C11H11ClN4O2S/c1-18-9-3-2-7(12)6-8(9)14-11(19)16-15-10(17)4-5-13/h2-3,6H,4H2,1H3,(H,15,17)(H2,14,16,19) |
| InChIKey | SKFNXDFBCKUTKE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.76 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|