C10H8Cl2N4OS — CID 146579570
1-[(2-cyanoacetyl)amino]-3-(2,5-dichlorophenyl)thiourea (PubChem CID 146579570) has the molecular formula C10H8Cl2N4OS and a molecular weight of 303.17 g/mol. Its IUPAC name is 1-[(2-cyanoacetyl)amino]-3-(2,5-dichlorophenyl)thiourea.
| Compound Name | 1-[(2-cyanoacetyl)amino]-3-(2,5-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 146579570 |
| Molecular Formula | C10H8Cl2N4OS |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | 1-[(2-cyanoacetyl)amino]-3-(2,5-dichlorophenyl)thiourea |
| SMILES | N#CCC(=O)NNC(=S)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C10H8Cl2N4OS/c11-6-1-2-7(12)8(5-6)14-10(18)16-15-9(17)3-4-13/h1-2,5H,3H2,(H,15,17)(H2,14,16,18) |
| InChIKey | ZSJHWGMRLFSNGH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 76.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|