C9H6Cl2N2O — CID 693146
2-cyano-N-(2,4-dichlorophenyl)acetamide (PubChem CID 693146) has the molecular formula C9H6Cl2N2O and a molecular weight of 229.07 g/mol. Its IUPAC name is 2-cyano-N-(2,4-dichlorophenyl)acetamide.
| Compound Name | 2-cyano-N-(2,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 693146 |
| Molecular Formula | C9H6Cl2N2O |
| Molecular Weight | 229.07 g/mol |
| Exact Mass | 227.99 |
| IUPAC Name | 2-cyano-N-(2,4-dichlorophenyl)acetamide |
| SMILES | N#CCC(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H6Cl2N2O/c10-6-1-2-8(7(11)5-6)13-9(14)3-4-12/h1-2,5H,3H2,(H,13,14) |
| InChIKey | XSNWFABKENMBQB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.07 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |