C10H8Cl2N2O3S — CID 96694943
2-(cyanomethylsulfonyl)-N-(2,4-dichlorophenyl)acetamide (PubChem CID 96694943) has the molecular formula C10H8Cl2N2O3S and a molecular weight of 307.16 g/mol. Its IUPAC name is 2-(cyanomethylsulfonyl)-N-(2,4-dichlorophenyl)acetamide.
| Compound Name | 2-(cyanomethylsulfonyl)-N-(2,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 96694943 |
| Molecular Formula | C10H8Cl2N2O3S |
| Molecular Weight | 307.16 g/mol |
| Exact Mass | 305.96 |
| IUPAC Name | 2-(cyanomethylsulfonyl)-N-(2,4-dichlorophenyl)acetamide |
| SMILES | N#CCS(=O)(=O)CC(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H8Cl2N2O3S/c11-7-1-2-9(8(12)5-7)14-10(15)6-18(16,17)4-3-13/h1-2,5H,4,6H2,(H,14,15) |
| InChIKey | USXSPFSDKILPFR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.16 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |