C15H12Cl3NO3S — CID 26589989
3-(4-chlorophenyl)sulfonyl-N-(2,4-dichlorophenyl)propanamide (PubChem CID 26589989) has the molecular formula C15H12Cl3NO3S and a molecular weight of 392.69 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfonyl-N-(2,4-dichlorophenyl)propanamide.
| Compound Name | 3-(4-chlorophenyl)sulfonyl-N-(2,4-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 26589989 |
| Molecular Formula | C15H12Cl3NO3S |
| Molecular Weight | 392.69 g/mol |
| Exact Mass | 390.96 |
| IUPAC Name | 3-(4-chlorophenyl)sulfonyl-N-(2,4-dichlorophenyl)propanamide |
| SMILES | O=C(CCS(=O)(=O)c1ccc(Cl)cc1)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H12Cl3NO3S/c16-10-1-4-12(5-2-10)23(21,22)8-7-15(20)19-14-6-3-11(17)9-13(14)18/h1-6,9H,7-8H2,(H,19,20) |
| InChIKey | DJSQIKRJNPCONC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.69 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |