C22H17Cl2NO4S — CID 41235092
3-(benzenesulfonyl)-N-[4-chloro-2-(2-chlorobenzoyl)phenyl]propanamide (PubChem CID 41235092) has the molecular formula C22H17Cl2NO4S and a molecular weight of 462.35 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-[4-chloro-2-(2-chlorobenzoyl)phenyl]propanamide.
| Compound Name | 3-(benzenesulfonyl)-N-[4-chloro-2-(2-chlorobenzoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 41235092 |
| Molecular Formula | C22H17Cl2NO4S |
| Molecular Weight | 462.35 g/mol |
| Exact Mass | 461.03 |
| IUPAC Name | 3-(benzenesulfonyl)-N-[4-chloro-2-(2-chlorobenzoyl)phenyl]propanamide |
| SMILES | O=C(CCS(=O)(=O)c1ccccc1)Nc1ccc(Cl)cc1C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C22H17Cl2NO4S/c23-15-10-11-20(18(14-15)22(27)17-8-4-5-9-19(17)24)25-21(26)12-13-30(28,29)16-6-2-1-3-7-16/h1-11,14H,12-13H2,(H,25,26) |
| InChIKey | XBVFHMMZLXAUOI-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.35 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |