C24H23NO4S — CID 16804021
4-(benzenesulfonyl)-N-(2-benzoyl-4-methylphenyl)butanamide (PubChem CID 16804021) has the molecular formula C24H23NO4S and a molecular weight of 421.52 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-N-(2-benzoyl-4-methylphenyl)butanamide.
| Compound Name | 4-(benzenesulfonyl)-N-(2-benzoyl-4-methylphenyl)butanamide |
|---|---|
| PubChem CID | 16804021 |
| Molecular Formula | C24H23NO4S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 4-(benzenesulfonyl)-N-(2-benzoyl-4-methylphenyl)butanamide |
| SMILES | Cc1ccc(NC(=O)CCCS(=O)(=O)c2ccccc2)c(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H23NO4S/c1-18-14-15-22(21(17-18)24(27)19-9-4-2-5-10-19)25-23(26)13-8-16-30(28,29)20-11-6-3-7-12-20/h2-7,9-12,14-15,17H,8,13,16H2,1H3,(H,25,26) |
| InChIKey | PCGHFHSTYGBUQQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |