C30H25FN2O5S — CID 44994815
N-(2-benzoyl-4-methylphenyl)-2-[3-(4-fluorophenyl)sulfonylpropanoylamino]benzamide (PubChem CID 44994815) has the molecular formula C30H25FN2O5S and a molecular weight of 544.60 g/mol. Its IUPAC name is N-(2-benzoyl-4-methylphenyl)-2-[3-(4-fluorophenyl)sulfonylpropanoylamino]benzamide.
| Compound Name | N-(2-benzoyl-4-methylphenyl)-2-[3-(4-fluorophenyl)sulfonylpropanoylamino]benzamide |
|---|---|
| PubChem CID | 44994815 |
| Molecular Formula | C30H25FN2O5S |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | N-(2-benzoyl-4-methylphenyl)-2-[3-(4-fluorophenyl)sulfonylpropanoylamino]benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccccc2NC(=O)CCS(=O)(=O)c2ccc(F)cc2)c(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C30H25FN2O5S/c1-20-11-16-27(25(19-20)29(35)21-7-3-2-4-8-21)33-30(36)24-9-5-6-10-26(24)32-28(34)17-18-39(37,38)23-14-12-22(31)13-15-23/h2-16,19H,17-18H2,1H3,(H,32,34)(H,33,36) |
| InChIKey | WHTVBZCOCCCZIE-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |