C29H24N2O3 — CID 2313037
N-[2-[(2-benzoyl-4-methylphenyl)carbamoyl]phenyl]-2-methylbenzamide (PubChem CID 2313037) has the molecular formula C29H24N2O3 and a molecular weight of 448.52 g/mol. Its IUPAC name is N-[2-[(2-benzoyl-4-methylphenyl)carbamoyl]phenyl]-2-methylbenzamide.
| Compound Name | N-[2-[(2-benzoyl-4-methylphenyl)carbamoyl]phenyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 2313037 |
| Molecular Formula | C29H24N2O3 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | N-[2-[(2-benzoyl-4-methylphenyl)carbamoyl]phenyl]-2-methylbenzamide |
| SMILES | Cc1ccc(NC(=O)c2ccccc2NC(=O)c2ccccc2C)c(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C29H24N2O3/c1-19-16-17-26(24(18-19)27(32)21-11-4-3-5-12-21)31-29(34)23-14-8-9-15-25(23)30-28(33)22-13-7-6-10-20(22)2/h3-18H,1-2H3,(H,30,33)(H,31,34) |
| InChIKey | IRNMCRWMJPQUJF-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |