C31H28N2O4 — CID 16828774
N-(2-benzoyl-4-methylphenyl)-2-[[2-(4-methoxy-3-methylphenyl)acetyl]amino]benzamide (PubChem CID 16828774) has the molecular formula C31H28N2O4 and a molecular weight of 492.58 g/mol. Its IUPAC name is N-(2-benzoyl-4-methylphenyl)-2-[[2-(4-methoxy-3-methylphenyl)acetyl]amino]benzamide.
| Compound Name | N-(2-benzoyl-4-methylphenyl)-2-[[2-(4-methoxy-3-methylphenyl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 16828774 |
| Molecular Formula | C31H28N2O4 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | N-(2-benzoyl-4-methylphenyl)-2-[[2-(4-methoxy-3-methylphenyl)acetyl]amino]benzamide |
| SMILES | COc1ccc(CC(=O)Nc2ccccc2C(=O)Nc2ccc(C)cc2C(=O)c2ccccc2)cc1C |
| InChI | InChI=1S/C31H28N2O4/c1-20-13-15-27(25(17-20)30(35)23-9-5-4-6-10-23)33-31(36)24-11-7-8-12-26(24)32-29(34)19-22-14-16-28(37-3)21(2)18-22/h4-18H,19H2,1-3H3,(H,32,34)(H,33,36) |
| InChIKey | IRXQQGJYZKXICH-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |