C29H24N2O3 — CID 10297535
N-[3-benzoyl-4-[[2-(4-methylphenyl)acetyl]amino]phenyl]benzamide (PubChem CID 10297535) has the molecular formula C29H24N2O3 and a molecular weight of 448.52 g/mol. Its IUPAC name is N-[3-benzoyl-4-[[2-(4-methylphenyl)acetyl]amino]phenyl]benzamide.
| Compound Name | N-[3-benzoyl-4-[[2-(4-methylphenyl)acetyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 10297535 |
| Molecular Formula | C29H24N2O3 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | N-[3-benzoyl-4-[[2-(4-methylphenyl)acetyl]amino]phenyl]benzamide |
| SMILES | Cc1ccc(CC(=O)Nc2ccc(NC(=O)c3ccccc3)cc2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H24N2O3/c1-20-12-14-21(15-13-20)18-27(32)31-26-17-16-24(30-29(34)23-10-6-3-7-11-23)19-25(26)28(33)22-8-4-2-5-9-22/h2-17,19H,18H2,1H3,(H,30,34)(H,31,32) |
| InChIKey | UORYEOUFLACLBH-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |