C36H30N2O5S2 — CID 11467815
(E)-N-[3-benzoyl-4-[[2-(4-methylphenyl)acetyl]amino]phenyl]-3-[4-(4-methylsulfonylphenyl)thiophen-2-yl]prop-2-enamide (PubChem CID 11467815) has the molecular formula C36H30N2O5S2 and a molecular weight of 634.78 g/mol. Its IUPAC name is (E)-N-[3-benzoyl-4-[[2-(4-methylphenyl)acetyl]amino]phenyl]-3-[4-(4-methylsulfonylphenyl)thiophen-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[3-benzoyl-4-[[2-(4-methylphenyl)acetyl]amino]phenyl]-3-[4-(4-methylsulfonylphenyl)thiophen-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 11467815 |
| Molecular Formula | C36H30N2O5S2 |
| Molecular Weight | 634.78 g/mol |
| Exact Mass | 634.16 |
| IUPAC Name | (E)-N-[3-benzoyl-4-[[2-(4-methylphenyl)acetyl]amino]phenyl]-3-[4-(4-methylsulfonylphenyl)thiophen-2-yl]prop-2-enamide |
| SMILES | Cc1ccc(CC(=O)Nc2ccc(NC(=O)/C=C/c3cc(-c4ccc(S(C)(=O)=O)cc4)cs3)cc2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H30N2O5S2/c1-24-8-10-25(11-9-24)20-35(40)38-33-18-14-29(22-32(33)36(41)27-6-4-3-5-7-27)37-34(39)19-15-30-21-28(23-44-30)26-12-16-31(17-13-26)45(2,42)43/h3-19,21-23H,20H2,1-2H3,(H,37,39)(H,38,40)/b19-15+ |
| InChIKey | XIRONSNHFSJDJB-XDJHFCHBSA-N |
| XLogP | 7.19 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.78 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|