C37H28N2O3 — CID 10166062
N-[3-benzoyl-4-[[2-(4-methylphenyl)acetyl]amino]phenyl]anthracene-9-carboxamide (PubChem CID 10166062) has the molecular formula C37H28N2O3 and a molecular weight of 548.64 g/mol. Its IUPAC name is N-[3-benzoyl-4-[[2-(4-methylphenyl)acetyl]amino]phenyl]anthracene-9-carboxamide.
| Compound Name | N-[3-benzoyl-4-[[2-(4-methylphenyl)acetyl]amino]phenyl]anthracene-9-carboxamide |
|---|---|
| PubChem CID | 10166062 |
| Molecular Formula | C37H28N2O3 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | N-[3-benzoyl-4-[[2-(4-methylphenyl)acetyl]amino]phenyl]anthracene-9-carboxamide |
| SMILES | Cc1ccc(CC(=O)Nc2ccc(NC(=O)c3c4ccccc4cc4ccccc34)cc2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C37H28N2O3/c1-24-15-17-25(18-16-24)21-34(40)39-33-20-19-29(23-32(33)36(41)26-9-3-2-4-10-26)38-37(42)35-30-13-7-5-11-27(30)22-28-12-6-8-14-31(28)35/h2-20,22-23H,21H2,1H3,(H,38,42)(H,39,40) |
| InChIKey | FIXGALISXZGSDD-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|