C31H28N2O3S — CID 139989647
3-[2-[3-benzoyl-4-[[2-(4-methylphenyl)acetyl]amino]phenyl]phenyl]-2-sulfanylpropanamide (PubChem CID 139989647) has the molecular formula C31H28N2O3S and a molecular weight of 508.64 g/mol. Its IUPAC name is 3-[2-[3-benzoyl-4-[[2-(4-methylphenyl)acetyl]amino]phenyl]phenyl]-2-sulfanylpropanamide.
| Compound Name | 3-[2-[3-benzoyl-4-[[2-(4-methylphenyl)acetyl]amino]phenyl]phenyl]-2-sulfanylpropanamide |
|---|---|
| PubChem CID | 139989647 |
| Molecular Formula | C31H28N2O3S |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | 3-[2-[3-benzoyl-4-[[2-(4-methylphenyl)acetyl]amino]phenyl]phenyl]-2-sulfanylpropanamide |
| SMILES | Cc1ccc(CC(=O)Nc2ccc(-c3ccccc3CC(S)C(N)=O)cc2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H28N2O3S/c1-20-11-13-21(14-12-20)17-29(34)33-27-16-15-24(18-26(27)30(35)22-7-3-2-4-8-22)25-10-6-5-9-23(25)19-28(37)31(32)36/h2-16,18,28,37H,17,19H2,1H3,(H2,32,36)(H,33,34) |
| InChIKey | JDLQPRRKRWBNJW-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|