C24H22ClN3O3S — CID 85061160
2-amino-N-[3-benzoyl-4-[[2-(4-chlorophenyl)acetyl]amino]phenyl]-3-sulfanylpropanamide (PubChem CID 85061160) has the molecular formula C24H22ClN3O3S and a molecular weight of 467.98 g/mol. Its IUPAC name is 2-amino-N-[3-benzoyl-4-[[2-(4-chlorophenyl)acetyl]amino]phenyl]-3-sulfanylpropanamide.
| Compound Name | 2-amino-N-[3-benzoyl-4-[[2-(4-chlorophenyl)acetyl]amino]phenyl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 85061160 |
| Molecular Formula | C24H22ClN3O3S |
| Molecular Weight | 467.98 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 2-amino-N-[3-benzoyl-4-[[2-(4-chlorophenyl)acetyl]amino]phenyl]-3-sulfanylpropanamide |
| SMILES | NC(CS)C(=O)Nc1ccc(NC(=O)Cc2ccc(Cl)cc2)c(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H22ClN3O3S/c25-17-8-6-15(7-9-17)12-22(29)28-21-11-10-18(27-24(31)20(26)14-32)13-19(21)23(30)16-4-2-1-3-5-16/h1-11,13,20,32H,12,14,26H2,(H,27,31)(H,28,29) |
| InChIKey | ZWJWHZWSGHWFAU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.98 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|