C19H22FN3O2 — CID 119289645
2-amino-N-[4-fluoro-3-[(2-phenylacetyl)amino]phenyl]pentanamide (PubChem CID 119289645) has the molecular formula C19H22FN3O2 and a molecular weight of 343.40 g/mol. Its IUPAC name is 2-amino-N-[4-fluoro-3-[(2-phenylacetyl)amino]phenyl]pentanamide.
| Compound Name | 2-amino-N-[4-fluoro-3-[(2-phenylacetyl)amino]phenyl]pentanamide |
|---|---|
| PubChem CID | 119289645 |
| Molecular Formula | C19H22FN3O2 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 2-amino-N-[4-fluoro-3-[(2-phenylacetyl)amino]phenyl]pentanamide |
| SMILES | CCCC(N)C(=O)Nc1ccc(F)c(NC(=O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C19H22FN3O2/c1-2-6-16(21)19(25)22-14-9-10-15(20)17(12-14)23-18(24)11-13-7-4-3-5-8-13/h3-5,7-10,12,16H,2,6,11,21H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | WIZGJCHFVQSOTL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |