C12H16FN3O2 — CID 107568539
5-[[(2S)-2-aminopentanoyl]amino]-2-fluorobenzamide (PubChem CID 107568539) has the molecular formula C12H16FN3O2 and a molecular weight of 253.28 g/mol. Its IUPAC name is 5-[[(2S)-2-aminopentanoyl]amino]-2-fluorobenzamide.
| Compound Name | 5-[[(2S)-2-aminopentanoyl]amino]-2-fluorobenzamide |
|---|---|
| PubChem CID | 107568539 |
| Molecular Formula | C12H16FN3O2 |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 5-[[(2S)-2-aminopentanoyl]amino]-2-fluorobenzamide |
| SMILES | CCC[C@H](N)C(=O)Nc1ccc(F)c(C(N)=O)c1 |
| InChI | InChI=1S/C12H16FN3O2/c1-2-3-10(14)12(18)16-7-4-5-9(13)8(6-7)11(15)17/h4-6,10H,2-3,14H2,1H3,(H2,15,17)(H,16,18)/t10-/m0/s1 |
| InChIKey | AFGCRZCZHWENRY-JTQLQIEISA-N |
| XLogP | 0.99 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |