C15H22FN3O2 — CID 65290752
5-[(6-amino-2-methylheptanoyl)amino]-2-fluorobenzamide (PubChem CID 65290752) has the molecular formula C15H22FN3O2 and a molecular weight of 295.36 g/mol. Its IUPAC name is 5-[(6-amino-2-methylheptanoyl)amino]-2-fluorobenzamide.
| Compound Name | 5-[(6-amino-2-methylheptanoyl)amino]-2-fluorobenzamide |
|---|---|
| PubChem CID | 65290752 |
| Molecular Formula | C15H22FN3O2 |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 5-[(6-amino-2-methylheptanoyl)amino]-2-fluorobenzamide |
| SMILES | CC(N)CCCC(C)C(=O)Nc1ccc(F)c(C(N)=O)c1 |
| InChI | InChI=1S/C15H22FN3O2/c1-9(4-3-5-10(2)17)15(21)19-11-6-7-13(16)12(8-11)14(18)20/h6-10H,3-5,17H2,1-2H3,(H2,18,20)(H,19,21) |
| InChIKey | UEQQBFUJAMVJQA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |