C15H12ClFN2O2 — CID 23332701
2-amino-N-(2-benzoyl-4-chlorophenyl)-2-fluoroacetamide (PubChem CID 23332701) has the molecular formula C15H12ClFN2O2 and a molecular weight of 306.72 g/mol. Its IUPAC name is 2-amino-N-(2-benzoyl-4-chlorophenyl)-2-fluoroacetamide.
| Compound Name | 2-amino-N-(2-benzoyl-4-chlorophenyl)-2-fluoroacetamide |
|---|---|
| PubChem CID | 23332701 |
| Molecular Formula | C15H12ClFN2O2 |
| Molecular Weight | 306.72 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 2-amino-N-(2-benzoyl-4-chlorophenyl)-2-fluoroacetamide |
| SMILES | NC(F)C(=O)Nc1ccc(Cl)cc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H12ClFN2O2/c16-10-6-7-12(19-15(21)14(17)18)11(8-10)13(20)9-4-2-1-3-5-9/h1-8,14H,18H2,(H,19,21) |
| InChIKey | IHSNVHKPCNBSPW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.72 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|