C26H24ClN3O3 — CID 52916197
N-(2-benzoyl-4-chlorophenyl)-2-(4-formylpiperazin-1-yl)-2-phenylacetamide (PubChem CID 52916197) has the molecular formula C26H24ClN3O3 and a molecular weight of 461.95 g/mol. Its IUPAC name is N-(2-benzoyl-4-chlorophenyl)-2-(4-formylpiperazin-1-yl)-2-phenylacetamide.
| Compound Name | N-(2-benzoyl-4-chlorophenyl)-2-(4-formylpiperazin-1-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 52916197 |
| Molecular Formula | C26H24ClN3O3 |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | N-(2-benzoyl-4-chlorophenyl)-2-(4-formylpiperazin-1-yl)-2-phenylacetamide |
| SMILES | O=CN1CCN(C(C(=O)Nc2ccc(Cl)cc2C(=O)c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H24ClN3O3/c27-21-11-12-23(22(17-21)25(32)20-9-5-2-6-10-20)28-26(33)24(19-7-3-1-4-8-19)30-15-13-29(18-31)14-16-30/h1-12,17-18,24H,13-16H2,(H,28,33) |
| InChIKey | NJAOFLAONCITFA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|