C21H15Cl2NO2 — CID 23879994
N-(2-benzoyl-4-methylphenyl)-2,5-dichlorobenzamide (PubChem CID 23879994) has the molecular formula C21H15Cl2NO2 and a molecular weight of 384.26 g/mol. Its IUPAC name is N-(2-benzoyl-4-methylphenyl)-2,5-dichlorobenzamide.
| Compound Name | N-(2-benzoyl-4-methylphenyl)-2,5-dichlorobenzamide |
|---|---|
| PubChem CID | 23879994 |
| Molecular Formula | C21H15Cl2NO2 |
| Molecular Weight | 384.26 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | N-(2-benzoyl-4-methylphenyl)-2,5-dichlorobenzamide |
| SMILES | Cc1ccc(NC(=O)c2cc(Cl)ccc2Cl)c(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C21H15Cl2NO2/c1-13-7-10-19(17(11-13)20(25)14-5-3-2-4-6-14)24-21(26)16-12-15(22)8-9-18(16)23/h2-12H,1H3,(H,24,26) |
| InChIKey | WDBCIQOGPRVQHW-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.26 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |