C28H21ClN2O3 — CID 17226391
3-benzamido-N-(2-benzoyl-4-chlorophenyl)-4-methylbenzamide (PubChem CID 17226391) has the molecular formula C28H21ClN2O3 and a molecular weight of 468.94 g/mol. Its IUPAC name is 3-benzamido-N-(2-benzoyl-4-chlorophenyl)-4-methylbenzamide.
| Compound Name | 3-benzamido-N-(2-benzoyl-4-chlorophenyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 17226391 |
| Molecular Formula | C28H21ClN2O3 |
| Molecular Weight | 468.94 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 3-benzamido-N-(2-benzoyl-4-chlorophenyl)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(Cl)cc2C(=O)c2ccccc2)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H21ClN2O3/c1-18-12-13-21(16-25(18)31-27(33)20-10-6-3-7-11-20)28(34)30-24-15-14-22(29)17-23(24)26(32)19-8-4-2-5-9-19/h2-17H,1H3,(H,30,34)(H,31,33) |
| InChIKey | BEBLPHRLWLTOHB-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.94 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |