C21H14Cl3NO3 — CID 4512455
N-(2-benzoyl-4-chlorophenyl)-3,5-dichloro-4-methoxybenzamide (PubChem CID 4512455) has the molecular formula C21H14Cl3NO3 and a molecular weight of 434.71 g/mol. Its IUPAC name is N-(2-benzoyl-4-chlorophenyl)-3,5-dichloro-4-methoxybenzamide.
| Compound Name | N-(2-benzoyl-4-chlorophenyl)-3,5-dichloro-4-methoxybenzamide |
|---|---|
| PubChem CID | 4512455 |
| Molecular Formula | C21H14Cl3NO3 |
| Molecular Weight | 434.71 g/mol |
| Exact Mass | 433.00 |
| IUPAC Name | N-(2-benzoyl-4-chlorophenyl)-3,5-dichloro-4-methoxybenzamide |
| SMILES | COc1c(Cl)cc(C(=O)Nc2ccc(Cl)cc2C(=O)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C21H14Cl3NO3/c1-28-20-16(23)9-13(10-17(20)24)21(27)25-18-8-7-14(22)11-15(18)19(26)12-5-3-2-4-6-12/h2-11H,1H3,(H,25,27) |
| InChIKey | APKVOLBZRBTILH-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.71 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |