C21H16Cl2N2O2 — CID 17226451
3-benzamido-N-(2,3-dichlorophenyl)-4-methylbenzamide (PubChem CID 17226451) has the molecular formula C21H16Cl2N2O2 and a molecular weight of 399.28 g/mol. Its IUPAC name is 3-benzamido-N-(2,3-dichlorophenyl)-4-methylbenzamide.
| Compound Name | 3-benzamido-N-(2,3-dichlorophenyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 17226451 |
| Molecular Formula | C21H16Cl2N2O2 |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 3-benzamido-N-(2,3-dichlorophenyl)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(Cl)c2Cl)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H16Cl2N2O2/c1-13-10-11-15(21(27)24-17-9-5-8-16(22)19(17)23)12-18(13)25-20(26)14-6-3-2-4-7-14/h2-12H,1H3,(H,24,27)(H,25,26) |
| InChIKey | UKBMYWJNVUOLFJ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |