C24H21Cl2N3O3 — CID 55630794
3-benzamido-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N,4-dimethylbenzamide (PubChem CID 55630794) has the molecular formula C24H21Cl2N3O3 and a molecular weight of 470.36 g/mol. Its IUPAC name is 3-benzamido-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N,4-dimethylbenzamide.
| Compound Name | 3-benzamido-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 55630794 |
| Molecular Formula | C24H21Cl2N3O3 |
| Molecular Weight | 470.36 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | 3-benzamido-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)N(C)CC(=O)Nc2c(Cl)cccc2Cl)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H21Cl2N3O3/c1-15-11-12-17(13-20(15)27-23(31)16-7-4-3-5-8-16)24(32)29(2)14-21(30)28-22-18(25)9-6-10-19(22)26/h3-13H,14H2,1-2H3,(H,27,31)(H,28,30) |
| InChIKey | APYOBHWAYJGIPZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.36 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |