C19H19Cl2N3O3 — CID 46472549
3-acetamido-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N,4-dimethylbenzamide (PubChem CID 46472549) has the molecular formula C19H19Cl2N3O3 and a molecular weight of 408.29 g/mol. Its IUPAC name is 3-acetamido-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N,4-dimethylbenzamide.
| Compound Name | 3-acetamido-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 46472549 |
| Molecular Formula | C19H19Cl2N3O3 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 3-acetamido-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N,4-dimethylbenzamide |
| SMILES | CC(=O)Nc1cc(C(=O)N(C)CC(=O)Nc2c(Cl)cccc2Cl)ccc1C |
| InChI | InChI=1S/C19H19Cl2N3O3/c1-11-7-8-13(9-16(11)22-12(2)25)19(27)24(3)10-17(26)23-18-14(20)5-4-6-15(18)21/h4-9H,10H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | IAGKWIDLCLCLNJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |