C22H20Cl2N2O3S — CID 126412486
N-(2,3-dichlorophenyl)-3-[(2,5-dimethylphenyl)sulfamoyl]-4-methylbenzamide (PubChem CID 126412486) has the molecular formula C22H20Cl2N2O3S and a molecular weight of 463.39 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-3-[(2,5-dimethylphenyl)sulfamoyl]-4-methylbenzamide.
| Compound Name | N-(2,3-dichlorophenyl)-3-[(2,5-dimethylphenyl)sulfamoyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 126412486 |
| Molecular Formula | C22H20Cl2N2O3S |
| Molecular Weight | 463.39 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | N-(2,3-dichlorophenyl)-3-[(2,5-dimethylphenyl)sulfamoyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C)c(NS(=O)(=O)c2cc(C(=O)Nc3cccc(Cl)c3Cl)ccc2C)c1 |
| InChI | InChI=1S/C22H20Cl2N2O3S/c1-13-7-8-14(2)19(11-13)26-30(28,29)20-12-16(10-9-15(20)3)22(27)25-18-6-4-5-17(23)21(18)24/h4-12,26H,1-3H3,(H,25,27) |
| InChIKey | IPRYFAQSAFHJHG-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.39 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |