C21H19ClN2O3S — CID 9411375
N-(2-chlorophenyl)-4-[(2,5-dimethylphenyl)sulfonylamino]benzamide (PubChem CID 9411375) has the molecular formula C21H19ClN2O3S and a molecular weight of 414.91 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-[(2,5-dimethylphenyl)sulfonylamino]benzamide.
| Compound Name | N-(2-chlorophenyl)-4-[(2,5-dimethylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 9411375 |
| Molecular Formula | C21H19ClN2O3S |
| Molecular Weight | 414.91 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | N-(2-chlorophenyl)-4-[(2,5-dimethylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Nc2ccc(C(=O)Nc3ccccc3Cl)cc2)c1 |
| InChI | InChI=1S/C21H19ClN2O3S/c1-14-7-8-15(2)20(13-14)28(26,27)24-17-11-9-16(10-12-17)21(25)23-19-6-4-3-5-18(19)22/h3-13,24H,1-2H3,(H,23,25) |
| InChIKey | YIXSRGHJMWQZPP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.91 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |