C27H24ClN3O5S2 — CID 3484763
N-[4-[(2-chlorophenyl)sulfamoyl]phenyl]-4-methyl-3-[(3-methylphenyl)sulfamoyl]benzamide (PubChem CID 3484763) has the molecular formula C27H24ClN3O5S2 and a molecular weight of 570.09 g/mol. Its IUPAC name is N-[4-[(2-chlorophenyl)sulfamoyl]phenyl]-4-methyl-3-[(3-methylphenyl)sulfamoyl]benzamide.
| Compound Name | N-[4-[(2-chlorophenyl)sulfamoyl]phenyl]-4-methyl-3-[(3-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 3484763 |
| Molecular Formula | C27H24ClN3O5S2 |
| Molecular Weight | 570.09 g/mol |
| Exact Mass | 569.08 |
| IUPAC Name | N-[4-[(2-chlorophenyl)sulfamoyl]phenyl]-4-methyl-3-[(3-methylphenyl)sulfamoyl]benzamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2cc(C(=O)Nc3ccc(S(=O)(=O)Nc4ccccc4Cl)cc3)ccc2C)c1 |
| InChI | InChI=1S/C27H24ClN3O5S2/c1-18-6-5-7-22(16-18)30-38(35,36)26-17-20(11-10-19(26)2)27(32)29-21-12-14-23(15-13-21)37(33,34)31-25-9-4-3-8-24(25)28/h3-17,30-31H,1-2H3,(H,29,32) |
| InChIKey | YDNVKRISRLCRBP-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.09 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |