C21H19ClN2O6S2 — CID 24510134
methyl 4-[[3-[(2-chlorophenyl)sulfamoyl]-4-methylphenyl]sulfamoyl]benzoate (PubChem CID 24510134) has the molecular formula C21H19ClN2O6S2 and a molecular weight of 494.98 g/mol. Its IUPAC name is methyl 4-[[3-[(2-chlorophenyl)sulfamoyl]-4-methylphenyl]sulfamoyl]benzoate.
| Compound Name | methyl 4-[[3-[(2-chlorophenyl)sulfamoyl]-4-methylphenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 24510134 |
| Molecular Formula | C21H19ClN2O6S2 |
| Molecular Weight | 494.98 g/mol |
| Exact Mass | 494.04 |
| IUPAC Name | methyl 4-[[3-[(2-chlorophenyl)sulfamoyl]-4-methylphenyl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)Nc2ccc(C)c(S(=O)(=O)Nc3ccccc3Cl)c2)cc1 |
| InChI | InChI=1S/C21H19ClN2O6S2/c1-14-7-10-16(13-20(14)32(28,29)24-19-6-4-3-5-18(19)22)23-31(26,27)17-11-8-15(9-12-17)21(25)30-2/h3-13,23-24H,1-2H3 |
| InChIKey | ZSIRQWOMIIFZAN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.98 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |