C21H20FN3O5S2 — CID 26950174
N-[4-[[3-[(2-fluorophenyl)sulfamoyl]-4-methylphenyl]sulfamoyl]phenyl]acetamide (PubChem CID 26950174) has the molecular formula C21H20FN3O5S2 and a molecular weight of 477.54 g/mol. Its IUPAC name is N-[4-[[3-[(2-fluorophenyl)sulfamoyl]-4-methylphenyl]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[3-[(2-fluorophenyl)sulfamoyl]-4-methylphenyl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 26950174 |
| Molecular Formula | C21H20FN3O5S2 |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | N-[4-[[3-[(2-fluorophenyl)sulfamoyl]-4-methylphenyl]sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2ccc(C)c(S(=O)(=O)Nc3ccccc3F)c2)cc1 |
| InChI | InChI=1S/C21H20FN3O5S2/c1-14-7-8-17(13-21(14)32(29,30)25-20-6-4-3-5-19(20)22)24-31(27,28)18-11-9-16(10-12-18)23-15(2)26/h3-13,24-25H,1-2H3,(H,23,26) |
| InChIKey | QYMPDBMUEPDHHC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |