C15H15FN2O3S — CID 134040597
N-[4-fluoro-3-[(4-methylphenyl)sulfonylamino]phenyl]acetamide (PubChem CID 134040597) has the molecular formula C15H15FN2O3S and a molecular weight of 322.36 g/mol. Its IUPAC name is N-[4-fluoro-3-[(4-methylphenyl)sulfonylamino]phenyl]acetamide.
| Compound Name | N-[4-fluoro-3-[(4-methylphenyl)sulfonylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 134040597 |
| Molecular Formula | C15H15FN2O3S |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | N-[4-fluoro-3-[(4-methylphenyl)sulfonylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(F)c(NS(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C15H15FN2O3S/c1-10-3-6-13(7-4-10)22(20,21)18-15-9-12(17-11(2)19)5-8-14(15)16/h3-9,18H,1-2H3,(H,17,19) |
| InChIKey | FSDLJAHELNYWJK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |