C15H12F4N2O3S — CID 22773509
N-[4-[[2-fluoro-5-(trifluoromethyl)phenyl]sulfamoyl]phenyl]acetamide (PubChem CID 22773509) has the molecular formula C15H12F4N2O3S and a molecular weight of 376.33 g/mol. Its IUPAC name is N-[4-[[2-fluoro-5-(trifluoromethyl)phenyl]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[2-fluoro-5-(trifluoromethyl)phenyl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 22773509 |
| Molecular Formula | C15H12F4N2O3S |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | N-[4-[[2-fluoro-5-(trifluoromethyl)phenyl]sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2cc(C(F)(F)F)ccc2F)cc1 |
| InChI | InChI=1S/C15H12F4N2O3S/c1-9(22)20-11-3-5-12(6-4-11)25(23,24)21-14-8-10(15(17,18)19)2-7-13(14)16/h2-8,21H,1H3,(H,20,22) |
| InChIKey | UMFZZKZNCNFESD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |