C21H18ClFN2O3S — CID 19062615
N-(3-chloro-4-fluorophenyl)-4-methyl-3-[(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 19062615) has the molecular formula C21H18ClFN2O3S and a molecular weight of 432.90 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-4-methyl-3-[(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-4-methyl-3-[(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 19062615 |
| Molecular Formula | C21H18ClFN2O3S |
| Molecular Weight | 432.90 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-4-methyl-3-[(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(C(=O)Nc3ccc(F)c(Cl)c3)ccc2C)cc1 |
| InChI | InChI=1S/C21H18ClFN2O3S/c1-13-3-8-17(9-4-13)29(27,28)25-20-11-15(6-5-14(20)2)21(26)24-16-7-10-19(23)18(22)12-16/h3-12,25H,1-2H3,(H,24,26) |
| InChIKey | XKXAGDCKFDRWBJ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.90 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |